What is the molecular formula of 1,4-Diazabicyclo[2.2.2]octane?
The molecular formula of 1,4-Diazabicyclo[2.2.2]octane is C6H12N2.
What is the molecular weight of 1,4-Diazabicyclo[2.2.2]octane?
The molecular weight of 1,4-Diazabicyclo[2.2.2]octane is 112.17 g/mol.
What are the synonyms for 1,4-Diazabicyclo[2.2.2]octane?
The synonyms for 1,4-Diazabicyclo[2.2.2]octane are Triethylenediamine and Dabco.
What is the IUPAC name of 1,4-Diazabicyclo[2.2.2]octane?
The IUPAC name of 1,4-Diazabicyclo[2.2.2]octane is 1,4-diazabicyclo[2.2.2]octane.
What is the InChI of 1,4-Diazabicyclo[2.2.2]octane?
The InChI of 1,4-Diazabicyclo[2.2.2]octane is InChI=1S/C6H12N2/c1-2-8-5-3-7(1)4-6-8/h1-6H2.
What is the InChIKey of 1,4-Diazabicyclo[2.2.2]octane?
The InChIKey of 1,4-Diazabicyclo[2.2.2]octane is IMNIMPAHZVJRPE-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Diazabicyclo[2.2.2]octane?
The canonical SMILES of 1,4-Diazabicyclo[2.2.2]octane is C1CN2CCN1CC2.
What is the CAS number of 1,4-Diazabicyclo[2.2.2]octane?
The CAS number of 1,4-Diazabicyclo[2.2.2]octane is 280-57-9.
What is the ChEMBL ID of 1,4-Diazabicyclo[2.2.2]octane?
The ChEMBL ID of 1,4-Diazabicyclo[2.2.2]octane is CHEMBL3183414.