What is the CAS number of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
The CAS number is 9082-00-2.
What are some of the synonyms of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
Some synonyms are PPG-Glycereth, Polyoxypropylene polyoxyethylene glyceryl ether, and Glycerol poly(oxyethylene, oxypropylene) ether.
What is the IUPAC Name of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
The IUPAC Name is Ethane-1,2-diol;propane-1,2-diol;propane-1,2,3-triol.
What is the molecular formula of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
The molecular formula is 3(C3H6O.C2H4O)x.C3H8O3.
What is the density of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
The density is 1.02g/ml.
What is the percentage of actives in Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1) contains 95% actives.
In what physical states can Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1) be found?
Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1) can be found in a liquid or solid physical state.
What are the typical applications of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1) is used as an emulsifying agent and dispersing agent. It is also used as a solubilizing agent.
What is the InChI key of Oxirane, 2-methyl-, polymer with oxirane, ether with 1,2,3-propanetriol (3:1)?
The InChI is InChI=1S/C3H8O3.C3H8O2.C2H6O2/c4-1-3(6)2-5;1-3(5)2-4;3-1-2-4/h3-6H,1-2H2;3-5H,2H2,1H3;3-4H,1-2H2.
PAGE TOP