What is the product name of the compound with CAS number 90052-75-8?
The product name is Octyldodecyl stearoyl stearate.
What is the molecular weight of Octyldodecyl stearoyl stearate?
The molecular weight is 847.47 g/mol.
What is the molecular formula of Octyldodecyl stearoyl stearate?
The molecular formula is C56H110O4.
What are some synonyms of Octyldodecyl stearoyl stearate?
Some synonyms include Octadecanoic acid, 12-((1-oxooctadecyl)oxy)-, 2-octyldodecyl ester, and 2-Octyldodecyl 12-((1-oxooctadecyl)oxy)octadecanoate.
What is the physical state of Octyldodecyl stearoyl stearate?
It is in a liquid state.
What are some typical applications of Octyldodecyl stearoyl stearate?
It is used as a dispersing agent, emulsion stabilizer, and lubricant.
What is the boiling point of Octyldodecyl stearoyl stearate?
The boiling point is 699.0±23.0 °C.
What is the density of Octyldodecyl stearoyl stearate?
The density is 0.882±0.06 g/ml.
What percentage of actives does Octyldodecyl stearoyl stearate contain?
It contains 95% actives.
What is the InChI Key of Octyldodecyl stearoyl stearate?
The InChI Key is InChI=1S/C56H110O4/c1-5-9-13-17-20-22-23-24-25-26-27-28-34-39-45-51-56(58)60-54(48-42-16-12-8-4)49-43-37-32-29-30-33-38-44-50-55(57)59-52-53(46-40-35-19-15-11-7-3)47-41-36-31-21-18-14-10-6-2/h53-54H,5-52H2,1-4H3.
PAGE TOP