What is the product name of CAS number 22801-45-2?
The product name is Octyldodecyl oleate.
What are some synonyms for Octyldodecyl oleate?
Synonyms include 9-Octadecenoic acid (9Z)-, 2-octyldodecyl ester and Oleic acid, octyldodecyl ester.
What is the molecular weight of Octyldodecyl oleate?
The molecular weight is 562.99.
What is the molecular formula of Octyldodecyl oleate?
The molecular formula is C38H74O2.
What is the InChI Key of Octyldodecyl oleate?
The InChI Key is InChI=1S/C38H74O2/c1-4-7-10-13-16-18-19-20-21-22-23-24-26-29-32-35-38(39)40-36-37(33-30-27-15-12-9-6-3)34-31-28-25-17-14-11-8-5-2/h20-21,37H,4-19,22-36H2,1-3H3/b21-20-.
What is the boiling point of Octyldodecyl oleate?
The boiling point is 608.0±34.0 °C.
What is the density of Octyldodecyl oleate?
The density is 0.861±0.06g/ml.
What are the typical applications of Octyldodecyl oleate?
It is used as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
What is the physical state of Octyldodecyl oleate?
It is in liquid form.
What is the percentage of actives in Octyldodecyl oleate?
The percentage of actives is 95%.