What is the CAS number for Octyldodecyl Erucate?
The CAS number for Octyldodecyl Erucate is 88103-59-7.
What is the IUPAC Name of Octyldodecyl Erucate?
The IUPAC Name of Octyldodecyl Erucate is Icosan-9-yl (Z)-docos-13-enoate.
What is the molecular weight of Octyldodecyl Erucate?
The molecular weight of Octyldodecyl Erucate is 619.1.
What is the molecular formula of Octyldodecyl Erucate?
The molecular formula of Octyldodecyl Erucate is C42H82O2.
What are the synonyms for Octyldodecyl Erucate?
The synonyms for Octyldodecyl Erucate are 13-Docosenoic acid(13Z)-, 2-octyldodecyl ester.
What is the SMILES representation of Octyldodecyl Erucate?
The SMILES representation of Octyldodecyl Erucate is CCCCCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCCCCC/C=C\CCCCCCCC.
What is the InChI Key of Octyldodecyl Erucate?
The InChI Key of Octyldodecyl Erucate is InChI=1S/C42H82O2/c1-4-7-10-13-16-18-19-20-21-22-23-24-25-26-27-29-31-34-37-40-42(43)44-41(38-35-32-15-12-9-6-3)39-36-33-30-28-17-14-11-8-5-2/h20-21,41H,4-19,22-40H2,1-3H3/b21-20-.
What is the percentage of actives in Octyldodecyl Erucate?
The percentage of actives in Octyldodecyl Erucate is 95%.
What is the physical state of Octyldodecyl Erucate?
The physical state of Octyldodecyl Erucate is liquid.
What are the typical applications of Octyldodecyl Erucate?
The typical applications of Octyldodecyl Erucate are as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.