
What is the CAS number of Octanoic acid, monoester with 1,2,3-propanetriol?
The CAS number is 26402-26-6.
What are some synonyms for Octanoic acid, monoester with 1,2,3-propanetriol?
Some synonyms include Glyceryl caprylate, Glyceryl monocaprylate, and Glyceryl monooctanoate.
What is the molecular weight of Octanoic acid, monoester with 1,2,3-propanetriol?
The molecular weight is 218.29.
What is the molecular formula of Octanoic acid, monoester with 1,2,3-propanetriol?
The molecular formula is C11H22O4.
What is the InChI Key for Octanoic acid, monoester with 1,2,3-propanetriol?
The InChI Key is InChI=1S/C11H22O4/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3.
What is the melting point range of Octanoic acid, monoester with 1,2,3-propanetriol?
The melting point range is 39-43 °C.
What is the physical state of Octanoic acid, monoester with 1,2,3-propanetriol?
The physical state is liquid.
What are some typical applications of Octanoic acid, monoester with 1,2,3-propanetriol?
Some typical applications include use as a lubricant, dispersing agent, emulsion stabilizer, and preservative.
What is the percentage of actives in Octanoic acid, monoester with 1,2,3-propanetriol?
The percentage of actives is 95%.
What is the IUPAC name of Octanoic acid, monoester with 1,2,3-propanetriol?
The IUPAC name is 2,3-Dihydroxypropyl octanoate.