What is the IUPAC Name of Octadecanoic acid, monoester with 1,2,3-propanetriol?
The IUPAC Name is 2,3-Dihydroxypropyl octadecanoate.
What is the molecular formula of Octadecanoic acid, monoester with 1,2,3-propanetriol?
The molecular formula is C21H42O4.
What is the CAS number of Octadecanoic acid, monoester with 1,2,3-propanetriol?
The CAS number is 31566-31-1.
What are some synonyms for Octadecanoic acid, monoester with 1,2,3-propanetriol?
Some synonyms are Glyceryl monostearate, Glyceryl stearate, and Stearic acid, monoester with glycerol.
What is the boiling point of Octadecanoic acid, monoester with 1,2,3-propanetriol?
The boiling point is 410.9 °C.
What is the melting point of Octadecanoic acid, monoester with 1,2,3-propanetriol?
The melting point is 78-81 °C.
What is the density of Octadecanoic acid, monoester with 1,2,3-propanetriol?
The density is 0.97g/ml.
What is the percentage of actives in Octadecanoic acid, monoester with 1,2,3-propanetriol?
The percentage of actives is 95%.
What are some typical applications of Octadecanoic acid, monoester with 1,2,3-propanetriol?
Some typical applications include its use as a lubricant, dispersing agent, and emulsion stabilizer.
What is the InChI Key for Octadecanoic acid, monoester with 1,2,3-propanetriol?
The InChI Key is InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3.
PAGE TOP