What is the IUPAC name of Octadecanoic acid, isodecyl ester?
The IUPAC name of Octadecanoic acid, isodecyl ester is 8-Methylnonyl octadecanoate.
What is the molecular weight of Octadecanoic acid, isodecyl ester?
The molecular weight of Octadecanoic acid, isodecyl ester is 424.74.
What is the molecular formula of Octadecanoic acid, isodecyl ester?
The molecular formula of Octadecanoic acid, isodecyl ester is C28H56O2.
What is the CAS number of Octadecanoic acid, isodecyl ester?
The CAS number of Octadecanoic acid, isodecyl ester is 31565-38-5.
What are some synonyms for Octadecanoic acid, isodecyl ester?
Some synonyms for Octadecanoic acid, isodecyl ester are Isodecyl octadecanoate.
What is the SMILES representation of Octadecanoic acid, isodecyl ester?
The SMILES representation of Octadecanoic acid, isodecyl ester is CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCC(C)C.
What are the typical applications of Octadecanoic acid, isodecyl ester?
The typical applications of Octadecanoic acid, isodecyl ester are as a synthetic ester and emollient.
What is the percentage of actives in Octadecanoic acid, isodecyl ester?
The percentage of actives in Octadecanoic acid, isodecyl ester is 95%.
What is the InChI Key for Octadecanoic acid, isodecyl ester?
The InChI Key for Octadecanoic acid, isodecyl ester is InChI=1S/C28H56O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-25-28(29)30-26-23-20-17-18-21-24-27(2)3/h27H,4-26H2,1-3H3.
What is the physical state of Octadecanoic acid, isodecyl ester?
The physical state of Octadecanoic acid, isodecyl ester is liquid.
PAGE TOP