What is the IUPAC name of Octadecanoic acid, 2-ethylhexyl ester?
The IUPAC name of Octadecanoic acid, 2-ethylhexyl ester is 2-Ethylhexyl octadecanoate.
What are some synonyms for Octadecanoic acid, 2-ethylhexyl ester?
Some synonyms for Octadecanoic acid, 2-ethylhexyl ester are 2-Ethylhexyl stearate and Ethylhexyl stearate.
What is the molecular weight of Octadecanoic acid, 2-ethylhexyl ester?
The molecular weight of Octadecanoic acid, 2-ethylhexyl ester is 396.69.
What is the molecular formula of Octadecanoic acid, 2-ethylhexyl ester?
The molecular formula of Octadecanoic acid, 2-ethylhexyl ester is C26H52O2.
What is the boiling point of Octadecanoic acid, 2-ethylhexyl ester?
The boiling point of Octadecanoic acid, 2-ethylhexyl ester is 420 °C.
What is the density of Octadecanoic acid, 2-ethylhexyl ester?
The density of Octadecanoic acid, 2-ethylhexyl ester is 0.879g/ml.
What are some typical applications of Octadecanoic acid, 2-ethylhexyl ester?
Some typical applications of Octadecanoic acid, 2-ethylhexyl ester are use as emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
What is the percentage of actives in Octadecanoic acid, 2-ethylhexyl ester?
The percentage of actives in Octadecanoic acid, 2-ethylhexyl ester is 95%.
What is the SMILES representation of Octadecanoic acid, 2-ethylhexyl ester?
The SMILES representation of Octadecanoic acid, 2-ethylhexyl ester is CCCCCCCCCCCCCCCCCC(=O)OCC(CC)CCCC.
What is the InChI Key of Octadecanoic acid, 2-ethylhexyl ester?
The InChI Key of Octadecanoic acid, 2-ethylhexyl ester is InChI=1S/C26H52O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-24-25(6-3)22-8-5-2/h25H,4-24H2,1-3H3.