What is the PubChem CID of Nordihydroguaiaretic acid?
PubChem CID 4534
What is the molecular formula of Nordihydroguaiaretic acid?
The molecular formula is C18H22O4.
What is the molecular weight of Nordihydroguaiaretic acid?
The molecular weight is 302.4 g/mol.
What is the IUPAC name of Nordihydroguaiaretic acid?
The IUPAC name is 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol.
What are the synonyms for Nordihydroguaiaretic acid?
The synonyms include NORDIHYDROGUAIARETIC ACID, NDGA, Dihydronorguaiaretic acid, Actinex, and more.
What is the InChI of Nordihydroguaiaretic acid?
The InChI is InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3.
What is the InChIKey of Nordihydroguaiaretic acid?
The InChIKey is HCZKYJDFEPMADG-UHFFFAOYSA-N.
What are the other identifiers for Nordihydroguaiaretic acid?
The other identifiers include CAS numbers (500-38-9, 27686-84-6, 1413-68-9), ChEMBL ID (CHEMBL52), DSSTox Substance ID (DTXSID5022437), KEGG ID (C10719), and more.
What is the XLogP3-AA value of Nordihydroguaiaretic acid?
The XLogP3-AA value is 4.3.
What is the hydrogen bond donor count of Nordihydroguaiaretic acid?
The hydrogen bond donor count is 4.
PAGE TOP