What is the product name of the compound with CAS number 27841-06-1?
The product name is Neopentyl glycol dicaprate.
What are the synonyms for Neopentyl glycol dicaprate?
The synonyms are 2,2-Dimethyl-1,3-propanediyl didecanoate and (3-Decanoyloxy-2,2-dimethylpropyl) decanoate.
What is the molecular weight of Neopentyl glycol dicaprate?
The molecular weight is 412.65 g/mol.
What is the molecular formula of Neopentyl glycol dicaprate?
The molecular formula is C25H48O4.
What is the SMILES notation for Neopentyl glycol dicaprate?
The SMILES notation is CCCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCCC.
What is the InChI key for Neopentyl glycol dicaprate?
The InChI key is InChI=1S/C25H48O4/c1-5-7-9-11-13-15-17-19-23(26)28-21-25(3,4)22-29-24(27)20-18-16-14-12-10-8-6-2/h5-22H2,1-4H3.
What is the boiling point of Neopentyl glycol dicaprate?
The boiling point is 483.5±18.0 °C.
What is the density of Neopentyl glycol dicaprate?
The density is 0.920±0.06g/ml.
What is the percentage of actives in Neopentyl glycol dicaprate?
The percentage of actives is 95%.
What are the typical applications of Neopentyl glycol dicaprate?
Neopentyl glycol dicaprate is used as an emollient and as a lipophilic viscosity increasing agent.
PAGE TOP