What is the product name of the compound with CAS number 30769-76-7?
The product name is N-Isobutyldiethanolamine.
What is the molecular weight of N-Isobutyldiethanolamine?
The molecular weight is 161.24.
What is the molecular formula of N-Isobutyldiethanolamine?
The molecular formula is C8H19NO2.
What is the IUPAC name of N-Isobutyldiethanolamine?
The IUPAC name is 2-[2-Hydroxyethyl(2-methylpropyl)amino]ethanol.
What is the boiling point of N-Isobutyldiethanolamine?
The boiling point is 128 °C.
What is the density of N-Isobutyldiethanolamine?
The density is 0.987±0.06g/ml.
What is the percentage of actives in N-Isobutyldiethanolamine?
The percentage of actives is 95%.
What is the physical state of N-Isobutyldiethanolamine?
The physical state is liquid.
What are some typical applications of N-Isobutyldiethanolamine?
Some typical applications include use as a solvent, cleansing agent, and emulsifying agent.
What is the InChI key for N-Isobutyldiethanolamine?
The InChI key is InChI=1S/C8H19NO2/c1-8(2)7-9(3-5-10)4-6-11/h8,10-11H,3-7H2,1-2H3.
PAGE TOP