What is the IUPAC name of N-Butyldiethanolamine?
The IUPAC name of N-Butyldiethanolamine is 2-[Butyl(2-hydroxyethyl)amino]ethanol.
What is the molecular weight of N-Butyldiethanolamine?
The molecular weight of N-Butyldiethanolamine is 161.24.
What is the molecular formula of N-Butyldiethanolamine?
The molecular formula of N-Butyldiethanolamine is C8H19NO2.
What is the SMILES notation for N-Butyldiethanolamine?
The SMILES notation for N-Butyldiethanolamine is CCCCN(CCO)CCO.
What is the InChI Key for N-Butyldiethanolamine?
The InChI Key for N-Butyldiethanolamine is InChI=1S/C8H19NO2/c1-2-3-4-9(5-7-10)6-8-11/h10-11H,2-8H2,1H3.
What is the boiling point of N-Butyldiethanolamine?
The boiling point of N-Butyldiethanolamine is 273-275 °C.
What is the melting point of N-Butyldiethanolamine?
The melting point of N-Butyldiethanolamine is -70 °C (lit.).
What is the density of N-Butyldiethanolamine?
The density of N-Butyldiethanolamine is 0.986g/ml.
What is the typical active percentage of N-Butyldiethanolamine?
The typical active percentage of N-Butyldiethanolamine is 95%.
What are some typical applications of N-Butyldiethanolamine?
Some typical applications of N-Butyldiethanolamine are as a solvent, cleansing agent, and emulsifying agent or dispersing agent.
PAGE TOP