What is the CAS number for N-Acetyl-beta-D-glucosamine?
The CAS number for N-Acetyl-beta-D-glucosamine is 7512-17-6.
What are some synonyms for N-Acetyl-beta-D-glucosamine?
Some synonyms for N-Acetyl-beta-D-glucosamine are N-Acetyl glucosamine, D-Glucose, 2-(acetylamino)-2-deoxy-, and Acetyl glucosamine.
What is the molecular weight of N-Acetyl-beta-D-glucosamine?
The molecular weight of N-Acetyl-beta-D-glucosamine is 221.21.
What is the molecular formula of N-Acetyl-beta-D-glucosamine?
The molecular formula of N-Acetyl-beta-D-glucosamine is C8H15NO6.
What is the IUPAC name of N-Acetyl-beta-D-glucosamine?
The IUPAC name of N-Acetyl-beta-D-glucosamine is N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
What is the InChI Key of N-Acetyl-beta-D-glucosamine?
The InChI Key of N-Acetyl-beta-D-glucosamine is InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8?/m1/s1.
What is the melting point of N-Acetyl-beta-D-glucosamine?
The melting point of N-Acetyl-beta-D-glucosamine is 211 °C (dec.) (lit.).
What is the density of N-Acetyl-beta-D-glucosamine?
The density of N-Acetyl-beta-D-glucosamine is 1.54g/ml.
What are the typical applications of N-Acetyl-beta-D-glucosamine?
The typical applications of N-Acetyl-beta-D-glucosamine include use as a dispersing agent and emulsifying agent.
What is the percentage of actives in N-Acetyl-beta-D-glucosamine?
The percentage of actives in N-Acetyl-beta-D-glucosamine is 95%.
PAGE TOP