What is the CAS number of Myristyl propionate?
The CAS number of Myristyl propionate is 6221-95-0.
What are some synonyms of Myristyl propionate?
Some synonyms of Myristyl propionate are Tetradecyl propionate and Tetradecyl propanoate.
What is the molecular weight of Myristyl propionate?
The molecular weight of Myristyl propionate is 270.45.
What is the molecular formula of Myristyl propionate?
The molecular formula of Myristyl propionate is C17H34O2.
What is the chemical structure of Myristyl propionate represented by SMILES notation?
The chemical structure of Myristyl propionate is represented by the SMILES notation CCCCCCCCCCCCCCOC(=O)CC.
What is the InChI key of Myristyl propionate?
The InChI key of Myristyl propionate is InChI=1S/C17H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-19-17(18)4-2/h3-16H2,1-2H3.
What is the density of Myristyl propionate?
The density of Myristyl propionate is 0.86g/ml.
What is the percentage of actives in Myristyl propionate?
The percentage of actives in Myristyl propionate is 95%.
What is the physical state of Myristyl propionate?
The physical state of Myristyl propionate is a liquid.
What are the typical applications of Myristyl propionate?
Some typical applications of Myristyl propionate are as an emollient, skin conditioning agent, and solvent.