What is the CAS number of Myristamide DEA?
The CAS number of Myristamide DEA is 7545-23-5.
What are some synonyms of Myristamide DEA?
Some synonyms of Myristamide DEA include N,N-Bis(2-hydroxyethyl)myristamide, Tetradecanamide, N,N-bis(2-hydroxyethyl)-, and Myristic acid diethanolamide.
What is the IUPAC name of Myristamide DEA?
The IUPAC name of Myristamide DEA is N,N-bis(2-hydroxyethyl)tetradecanamide.
What is the molecular weight of Myristamide DEA?
The molecular weight of Myristamide DEA is 315.49.
What is the molecular formula of Myristamide DEA?
The molecular formula of Myristamide DEA is C18H37NO3.
What is the SMILES notation for Myristamide DEA?
The SMILES notation for Myristamide DEA is CCCCCCCCCCCCCC(=O)N(CCO)CCO.
What is the InChI Key for Myristamide DEA?
The InChI Key for Myristamide DEA is InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-18(22)19(14-16-20)15-17-21/h20-21H,2-17H2,1H3.
What is the physical state of Myristamide DEA?
The physical state of Myristamide DEA is solid.
What are some typical applications of Myristamide DEA?
Some typical applications of Myristamide DEA include its use as a cleansing agent, emulsifying agent, dispersing agent, and solubilizing agent.
What is the percentage of actives in Myristamide DEA?
The percentage of actives in Myristamide DEA is 95%.
PAGE TOP