What is the CAS number of Methyl Linoleate?
The CAS number of Methyl Linoleate is 112-63-0.
What are some synonyms for Methyl Linoleate?
Some synonyms for Methyl Linoleate are Linoleic Acid Methyl Ester.
What is the molecular weight of Methyl Linoleate?
The molecular weight of Methyl Linoleate is 294.47.
What is the molecular formula of Methyl Linoleate?
The molecular formula of Methyl Linoleate is C19H34O2.
What is the appearance of Methyl Linoleate?
Methyl Linoleate appears as a clear pale to dark yellow liquid.
What is the typical purity of Methyl Linoleate?
The typical purity of Methyl Linoleate is 94%.
What are the typical applications of Methyl Linoleate?
Methyl Linoleate is used as a lubricant, dispersing agent, emulsion stabilizer, and intermediate in organic synthesis.
What is the physical state of Methyl Linoleate?
Methyl Linoleate is in a liquid state.
What is the boiling point of Methyl Linoleate?
The boiling point of Methyl Linoleate is 207-208 °C at 11 mmHg.
What is the InChI Key of Methyl Linoleate?
The InChI Key of Methyl Linoleate is InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7-,11-10-
PAGE TOP