What is the CAS number of Methyl eugenol?
The CAS number of Methyl eugenol is 93-15-2.
What is the molecular formula of Methyl eugenol?
The molecular formula of Methyl eugenol is C11H14O2.
What is the IUPAC name of Methyl eugenol?
The IUPAC name of Methyl eugenol is 1,2-Dimethoxy-4-prop-2-enylbenzene.
What is the boiling point of Methyl eugenol?
The boiling point of Methyl eugenol is 254-255 °C.
What is the melting point of Methyl eugenol?
The melting point of Methyl eugenol is -4 °C.
What are some synonyms of Methyl eugenol?
Some synonyms of Methyl eugenol are Benzene, 1,2-dimethoxy-4-(2-propen-1-yl)- and Benzene, 4-allyl-1,2-dimethoxy-.
What is the density of Methyl eugenol?
The density of Methyl eugenol is 1.036g/ml.
What are the typical applications of Methyl eugenol?
The typical applications of Methyl eugenol are use as perfume, use as solvent, and use as cleansing agent.
What percentage of actives does Methyl eugenol contain?
Methyl eugenol contains 95% actives.
What is the InChI Key of Methyl eugenol?
The InChI Key of Methyl eugenol is InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3.