What is the product name of CAS number 61788-59-8?
The product name is Methyl cocoate.
What are the synonyms for Methyl cocoate?
The synonyms are Fatty acids, coco, methyl esters and Fatty acids, coco, Me esters.
What is the IUPAC Name of Methyl cocoate?
The IUPAC Name is Methyl tridecanoate.
What is the molecular weight of Methyl cocoate?
The molecular weight of Methyl cocoate is 228.37.
What is the molecular formula of Methyl cocoate?
The molecular formula is C14H28O2.
What is the SMILES representation of Methyl cocoate?
The SMILES representation is CCCCCCCCCCCC(=O)OC.
What is the InChI of Methyl cocoate?
The InChI is JNDDPBOKWCBQSM-UHFFFAOYSA-N.
What is the InChI Key of Methyl cocoate?
The InChI Key is InChI=1S/C14H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14(15)16-2/h3-13H2,1-2H3.
What is the percentage of actives in Methyl cocoate?
The percentage of actives is 95%.
What are some typical applications of Methyl cocoate?
Some typical applications include use as a lubricant, dispersing agent, and emulsion stabilizer.