What is the molecular formula of Methyl acetyl ricinoleate?
The molecular formula of Methyl acetyl ricinoleate is C21H38O4.
What is the molecular weight of Methyl acetyl ricinoleate?
The molecular weight of Methyl acetyl ricinoleate is 354.5 g/mol.
What are some synonyms for Methyl acetyl ricinoleate?
Some synonyms for Methyl acetyl ricinoleate are Flexricin P-4 and Methyl 12-acetoxyoleate.
How is the IUPAC name of Methyl acetyl ricinoleate computed?
The IUPAC name of Methyl acetyl ricinoleate is computed by Lexichem TK 2.7.0.
What is the Canonical SMILES for Methyl acetyl ricinoleate?
The Canonical SMILES for Methyl acetyl ricinoleate is CCCCCCC(CC=CCCCCCCCC(=O)OC)OC(=O)C.
What is the InChIKey for Methyl acetyl ricinoleate?
The InChIKey for Methyl acetyl ricinoleate is CMOYPQWMTBSLJK-ACQXMXPUSA-N.
How many hydrogen bond acceptor counts does Methyl acetyl ricinoleate have?
Methyl acetyl ricinoleate has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of Methyl acetyl ricinoleate?
The topological polar surface area of Methyl acetyl ricinoleate is 52.6Ų.
How many defined atom stereocenter counts does Methyl acetyl ricinoleate have?
Methyl acetyl ricinoleate has 1 defined atom stereocenter count.
What is the formal charge of Methyl acetyl ricinoleate?
The formal charge of Methyl acetyl ricinoleate is 0.
PAGE TOP