What is the product name of CAS number 5760-50-9?
The product name is Methyl 9-undecylenate.
What are some synonyms for Methyl 9-undecylenate?
Some synonyms are 9-Undecenoic acid, methyl ester; Methyl undec-9-enoate; Methyl 9-undecenoate.
What is the IUPAC Name of Methyl 9-undecylenate?
The IUPAC Name is methyl (E)-undec-9-enoate.
What is the molecular weight of Methyl 9-undecylenate?
The molecular weight is 198.3.
What is the molecular formula of Methyl 9-undecylenate?
The molecular formula is C12H22O2.
What is the boiling point of Methyl 9-undecylenate?
The boiling point is 275.5°C.
What is the density of Methyl 9-undecylenate?
The density is 0.97g/ml.
What are the typical applications of Methyl 9-undecylenate?
The typical application is in perfume.
What is the percentage of actives in Methyl 9-undecylenate?
The percentage of actives is 95%.
What is the InChI Key of Methyl 9-undecylenate?
The InChI Key is InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3-4H,5-11H2,1-2H3/b4-3+.
PAGE TOP