
What is the IUPAC name of Methoxypropylgluconamide?
The IUPAC Name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-methoxypropyl)hexanamide.
What is the molecular weight of Methoxypropylgluconamide?
The molecular weight is 267.28.
What is the molecular formula of Methoxypropylgluconamide?
The molecular formula is C10H21NO7.
What is the CAS number of Methoxypropylgluconamide?
The CAS number is 126094-21-1.
What is the SMILES notation for Methoxypropylgluconamide?
The SMILES notation is COCCCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.
What is the InChI Key for Methoxypropylgluconamide?
The InChI Key is InChI=1S/C10H21NO7/c1-18-4-2-3-11-10(17)9(16)8(15)7(14)6(13)5-12/h6-9,12-16H,2-5H2,1H3,(H,11,17)/t6-,7-,8+,9-/m1/s1.
What is the percentage of actives in Methoxypropylgluconamide?
The actives constitute 95%.
What is the physical state of Methoxypropylgluconamide?
It is a solid.
What are the typical applications of Methoxypropylgluconamide?
It is used for skin conditioning.
What are the synonyms for Methoxypropylgluconamide?
Synonyms include D-Gluconamide, N-(3-methoxypropyl)-.