What is the CAS number of Methoxy PEG/PPG aminopropyl dimethicone?
The CAS number of Methoxy PEG/PPG aminopropyl dimethicone is 298211-68-4.
What is the molecular weight of Methoxy PEG/PPG aminopropyl dimethicone?
The molecular weight of Methoxy PEG/PPG aminopropyl dimethicone is 588.12.
What is the molecular formula of Methoxy PEG/PPG aminopropyl dimethicone?
The molecular formula of Methoxy PEG/PPG aminopropyl dimethicone is C22H57NO7Si5.
What are some synonyms for Methoxy PEG/PPG aminopropyl dimethicone?
Some synonyms for Methoxy PEG/PPG aminopropyl dimethicone are Siloxanes and silicones, 3-aminopropyl methyl, dimethyl, 3-hydroxypropyl methyl, ethers with polyethylene-polypropylene glycol mono-methyl ether.
What is the IUPAC Name of Methoxy PEG/PPG aminopropyl dimethicone?
The IUPAC Name of Methoxy PEG/PPG aminopropyl dimethicone is 3-[[[Dimethyl(trimethylsilyloxy)silyl]oxy-[3-[2-(2-methoxypropoxy)ethoxy]propyl]-methylsilyl]oxy-methyl-trimethylsilyloxysilyl]propan-1-amine.
What is the SMILES notation for Methoxy PEG/PPG aminopropyl dimethicone?
The SMILES notation for Methoxy PEG/PPG aminopropyl dimethicone is CC(COCCOCCC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(CCCN)O[Si](C)(C)C)OC.
What is the InChI Key of Methoxy PEG/PPG aminopropyl dimethicone?
The InChI Key of Methoxy PEG/PPG aminopropyl dimethicone is InChI=1S/C22H57NO7Si5/c1-22(24-2)21-26-18-17-25-16-14-20-35(12,29-33(9,10)27-31(3,4)5)30-34(11,19-13-15-23)28-32(6,7)8/h22H,13-21,23H2,1-12H3.
What percentage of actives does Methoxy PEG/PPG aminopropyl dimethicone contain?
Methoxy PEG/PPG aminopropyl dimethicone contains 95% actives.
What is the physical state of Methoxy PEG/PPG aminopropyl dimethicone?
The physical state of Methoxy PEG/PPG aminopropyl dimethicone is solid.
What are some typical applications of Methoxy PEG/PPG aminopropyl dimethicone?
Some typical applications of Methoxy PEG/PPG aminopropyl dimethicone include being used as a softening agent, antistatic agent, and brightening agent in textile, fiber, and leather industries.
PAGE TOP