What is the molecular formula of Maltodextrin?
The molecular formula of Maltodextrin is C12H22O11.
What is the molecular weight of Maltodextrin?
The molecular weight of Maltodextrin is 342.30 g/mol.
What is the IUPAC name of Maltodextrin?
Maltodextrin does not have an IUPAC name listed in the reference.
What is the InChI of Maltodextrin?
The InChI of Maltodextrin is InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1.
What is the InChIKey of Maltodextrin?
The InChIKey of Maltodextrin is GUBGYTABKSRVRQ-ASMJPISFSA-N.
What are the synonyms of Maltodextrin?
Some synonyms of Maltodextrin include alpha-Maltose and Thyodene.
What is the CAS number of Maltodextrin?
The CAS number of Maltodextrin is 4482-75-1.
What is the common use of Maltodextrin?
Maltodextrin is used as a food additive and as a carbohydrate supplement. It is used to provide and sustain energy levels during endurance-oriented workouts or sports, and to help build muscle mass and support weight gain.
Is Maltodextrin a natural product?
Maltodextrin is derived from starch and is considered an oligosaccharide. While it can be derived from natural sources, it is also commonly produced through various industrial processes.
What other organisms can Maltodextrin be found in?
Maltodextrin can be found in organisms such as Cyperus esculentus and Phytelephas aequatorialis, according to the reference.
PAGE TOP