What is the IUPAC name of Laurylamine dipropylenediamine?
The IUPAC name of Laurylamine dipropylenediamine is N'-(3-aminopropyl)-N'-dodecylpropane-1,3-diamine.
What is the CAS number of Laurylamine dipropylenediamine?
The CAS number of Laurylamine dipropylenediamine is 2372-82-9.
What is the molecular weight of Laurylamine dipropylenediamine?
The molecular weight of Laurylamine dipropylenediamine is 299.54.
What is the boiling point of Laurylamine dipropylenediamine?
The boiling point of Laurylamine dipropylenediamine is 182-184 °C.
What is the flash point of Laurylamine dipropylenediamine?
The flash point of Laurylamine dipropylenediamine is 184.5°C.
What is the density of Laurylamine dipropylenediamine?
The density of Laurylamine dipropylenediamine is 0.88g/ml.
What is the appearance of Laurylamine dipropylenediamine?
The appearance of Laurylamine dipropylenediamine is liquid.
What are some typical applications of Laurylamine dipropylenediamine?
Some typical applications of Laurylamine dipropylenediamine include use as an antistatic agent, emulsifying agent, dispersing agent, corrosion inhibitor, and lubricant.
What is the percentage of actives in Laurylamine dipropylenediamine?
The percentage of actives in Laurylamine dipropylenediamine is 95%.
What is the InChI Key of Laurylamine dipropylenediamine?
The InChI Key of Laurylamine dipropylenediamine is InChI=1S/C18H41N3/c1-2-3-4-5-6-7-8-9-10-11-16-21(17-12-14-19)18-13-15-20/h2-20H2,1H3.
PAGE TOP