What is the PubChem CID of L-serine?
The PubChem CID of L-serine is 5951.
What is the molecular formula of L-serine?
The molecular formula of L-serine is C3H7NO3.
Is L-serine a natural or synthetic compound?
L-serine is a natural compound.
What are the synonyms of L-serine?
The synonyms of L-serine include serine, 56-45-1, (S)-2-Amino-3-hydroxypropanoic acid, and (S)-Serine.
Is L-serine an essential amino acid?
L-serine is a non-essential amino acid.
What is the molecular weight of L-serine?
The molecular weight of L-serine is 105.09 g/mol.
What is the IUPAC name of L-serine?
The IUPAC name of L-serine is (2S)-2-amino-3-hydroxypropanoic acid.
What is the InChI of L-serine?
The InChI of L-serine is InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1.
What is the CAS number of L-serine?
The CAS number of L-serine is 56-45-1.
What is the hydrogen bond donor count of L-serine?
The hydrogen bond donor count of L-serine is 3.