What is the product name of the chemical with CAS number 159317-32-5?
The product name of the chemical is Isostearyl glycolate.
What is the IUPAC name of Isostearyl glycolate?
The IUPAC name of Isostearyl glycolate is 16-Methylheptadecyl 2-hydroxyacetate.
What is the molecular weight of Isostearyl glycolate?
The molecular weight of Isostearyl glycolate is 328.53.
What is the molecular formula of Isostearyl glycolate?
The molecular formula of Isostearyl glycolate is C20H40O3.
What are the synonyms of Isostearyl glycolate?
Some synonyms of Isostearyl glycolate are Acetic acid, 2-hydroxy-, isooctadecyl ester.
What is the SMILES notation for Isostearyl glycolate?
The SMILES notation for Isostearyl glycolate is CC(C)CCCCCCCCCCCCCCCOC(=O)CO.
What is the InChI key for Isostearyl glycolate?
The InChI key for Isostearyl glycolate is InChI=1S/C20H40O3/c1-19(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-23-20(22)18-21/h19,21H,3-18H2,1-2H3.
What is the physical state of Isostearyl glycolate?
Isostearyl glycolate is in a liquid physical state.
What percentage of Isostearyl glycolate is considered active?
Isostearyl glycolate is considered to be 95% active.
What are some typical applications of Isostearyl glycolate?
Some typical applications of Isostearyl glycolate include being used as a binding agent, emollient, and solvent.
PAGE TOP