What is the chemical name of Isostearyl alcohol?
The chemical name of Isostearyl alcohol is Isooctadecan-1-ol or Isooctadecanol.
What is the IUPAC name of Isostearyl alcohol?
The IUPAC name of Isostearyl alcohol is 16-Methylheptadecan-1-ol.
What is the molecular weight of Isostearyl alcohol?
The molecular weight of Isostearyl alcohol is 270.49.
What is the molecular formula of Isostearyl alcohol?
The molecular formula of Isostearyl alcohol is C18H38O.
What are some synonyms for Isostearyl alcohol?
Some synonyms for Isostearyl alcohol are Isooctadecan-1-ol and Isooctadecanol.
What is the InChI of Isostearyl alcohol?
The InChI of Isostearyl alcohol is InChI=1S/C18H38O/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h18-19H,3-17H2,1-2H3.
What is the InChI Key of Isostearyl alcohol?
The InChI Key of Isostearyl alcohol is WNWHHMBRJJOGFJ-UHFFFAOYSA-N.
What is the physical state of Isostearyl alcohol?
Isostearyl alcohol is in a liquid physical state.
What are some typical applications of Isostearyl alcohol?
Some typical applications of Isostearyl alcohol are as an emulsifying agent, dispersing agent, lubricant, and intermediate in organic synthesis.
What is the percentage of actives in Isostearyl alcohol?
Isostearyl alcohol contains 95% actives.