What is the product name?
The product name is Isooctadecanoic acid, monoester with 1,2,3-propanetriol.
What is the CAS number of the compound?
The CAS number is 66085-00-5.
What are some synonyms for Isooctadecanoic acid, monoester with 1,2,3-propanetriol?
Some synonyms include Glyceryl isostearate and Glyceryl monoisostearate.
What is the IUPAC name of the compound?
The IUPAC name is 2,3-Dihydroxypropyl 16-methylheptadecanoate.
What is the molecular weight of the compound?
The molecular weight is 358.56.
What is the molecular formula of the compound?
The molecular formula is C21H42O4.
What is the SMILES notation of the compound?
The SMILES notation is CC(C)CCCCCCCCCCCCCCC(=O)OCC(CO)O.
What is the InChI key of the compound?
The InChI key is InChI=1S/C21H42O4/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(24)25-18-20(23)17-22/h19-20,22-23H,3-18H2,1-2H3.
What is the physical state of the compound?
The physical state is liquid.
What are typical applications of Isooctadecanoic acid, monoester with 1,2,3-propanetriol?
Typical applications include use as a lubricant, dispersing agent, and emulsion stabilizer.