What is the product name of the chemical with CAS number 8029-68-3?
The product name is Ichthammol.
What are some synonyms for Ichthammol?
One synonym for Ichthammol is Ichthammonium.
What is the IUPAC name of Ichthammol?
The IUPAC Name of Ichthammol is hydroxyurea.
What is the SMILES representation of Ichthammol?
The SMILES representation of Ichthammol is C(=O)(N)NO.
What is the InChI representation of Ichthammol?
The InChI representation of Ichthammol is VSNHCAURESNICA-UHFFFAOYSA-N.
What is the percentage of actives in Ichthammol?
The percentage of actives in Ichthammol is 95%.
What is the physical state of Ichthammol?
Ichthammol is in liquid physical state.
What is the typical application of Ichthammol?
The typical application of Ichthammol is as an antimicrobial agent.
What is the chemical formula of Ichthammol?
The chemical formula of Ichthammol is CH4N2O2.
What is the InChI Key of Ichthammol?
The InChI Key of Ichthammol is InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4).
PAGE TOP