phone
Email
Online Inquiry
Verification code

Hydrolyzed Keratin

Catalog Number
ACM69430360-1
CAS
69430-36-0
IUPAC Name
2-bromo-2-chloroacetic acid
Synonyms
Keratins, hydrolyzates
Canonical SMILES
C(C(=O)O)(Cl)Br
InChI
GEHJBWKLJVFKPS-UHFFFAOYSA-N
InChI Key
InChI=1S/C2H2BrClO2/c3-1(4)2(5)6/h1H,(H,5,6)
Appearance
white to pale yellow powder or liquid
Application
1. Hair care: Hydrolyzed keratin is commonly used in hair care products due to its ability to penetrate the hair shaft, improve hair strength, and repair damage caused by heat and chemicals.
2. Skin care: Hydrolyzed keratin is also found in some skincare products due to its moisturizing and anti-aging benefits. It can help improve skin texture and elasticity by promoting collagen formation.
3. Nail care: Hydrolyzed keratin is used in some nail care products, such as nail strengtheners, to help strengthen and protect the nails.
4. Nutritional supplements: Hydrolyzed keratin is used as a source of protein in some nutritional supplements, particularly those targeted towards hair, skin, and nail health.
Active Content
90%
Physical State
Solid
Typical Applications
Antistatic; Film-forming agent; Humectant
Spec Sheet
Custom Q&A

What is hydrolyzed keratin?

Hydrolyzed keratin is a large protein molecule that has gone through a chemical process, breaking it down to allow it to penetrate the hair cuticle.

How does hydrolyzed keratin work on the hair?

Hydrolyzed keratin fills in minor gaps in the hair shaft, strengthening the hair's structure and improving its elasticity.

What are the benefits of hydrolyzed keratin for hair?

Hydrolyzed keratin strengthens and protects the hair, reduces damage from sun exposure and styling, fights frizz, softens the hair, moisturizes it, and increases density for a fuller appearance.

What is the origin of hydrolyzed keratin?

Hydrolyzed keratin is derived from sheep's wool.

How is hydrolyzed keratin used in hair care products?

It is used in shampoos, conditioners, leave-in treatments, and styling products to smooth and moisturize damaged hair, eliminate frizz, and improve overall hair health.

What other products can hydrolyzed keratin be found in?

Hydrolyzed keratin can also be found in creams, lotions, moisturizers, nail creams, serums, body wash, body lotion, cleansers, toners, facial moisturizers, makeup foundations, mascaras, lipsticks, and color cosmetics.

What are the safety considerations for hydrolyzed keratin?

Hydrolyzed keratin is considered safe for use in cosmetics and personal care products.

What is the pH value of hydrolyzed keratin?

The pH value of hydrolyzed keratin is between 5.0 and 5.8.

What percentage of protein does hydrolyzed keratin contain?

Hydrolyzed keratin contains between 20-23% protein.

How is hydrolyzed keratin preserved?

It is preserved with butylene glycol, phenoxyethanol, and ethylhexlglycerin.

❈ Please kindly note that our products are for research use only.