What is the IUPAC name of the compound with CAS number 70969-70-9?
The IUPAC name of the compound with CAS number 70969-70-9 is 2-Ethylhexyl 3,5,5-trimethylhexanoate.
What is the molecular weight of the compound?
The molecular weight of the compound is 270.45.
What is the molecular formula of the compound?
The molecular formula of the compound is C17H34O2.
What is the SMILES notation for the compound?
The SMILES notation for the compound is CCCCC(CC)COC(=O)CC(C)CC(C)(C)C.
What is the InChI for the compound?
The InChI for the compound is LCVHZNSIAYNAGX-UHFFFAOYSA-N.
What is the InChI key for the compound?
The InChI key for the compound is InChI=1S/C17H34O2/c1-7-9-10-15(8-2)13-19-16(18)11-14(3)12-17(4,5)6/h14-15H,7-13H2,1-6H3.
What is the percentage of actives in the compound?
The compound contains 95% actives.
In what physical state is the compound?
The compound is in a liquid physical state.
What are some typical applications of the compound?
Some typical applications of the compound include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
What are some synonyms for the compound?
Some synonyms for the compound include 2-Ethylhexyl 3,5,5-trimethylhexanoate.
PAGE TOP