What is the product name of the substance with CAS number 9008-02-0?
The product name is Hemoglobin.
What is the IUPAC name of Hemoglobin?
The IUPAC name is 2-(furan-2-yl)-7-methyl-1H-1,8-naphthyridin-4-one.
What is the molecular weight of Hemoglobin?
The molecular weight is 226.23.
What is the molecular formula of Hemoglobin?
The molecular formula is C13H10N2O2.
What is the SMILES notation for Hemoglobin?
The SMILES notation is CC1=NC2=C(C=C1)C(=O)C=C(N2)C3=CC=CO3.
What is the InChI for Hemoglobin?
The InChI is INGWEZCOABYORO-UHFFFAOYSA-N.
What is the InChI Key for Hemoglobin?
The InChI Key is InChI=1S/C13H10N2O2/c1-8-4-5-9-11(16)7-10(15-13(9)14-8)12-3-2-6-17-12/h2-7H,1H3,(H,14,15,16).
What is the percentage of actives in Hemoglobin?
The percentage of actives in Hemoglobin is 90%.
What is the physical state of Hemoglobin?
The physical state is solid.
What is the chemical structure of Hemoglobin composed of?
The chemical structure is a fused ring system consisting of a furan ring and a naphthyridine ring with a carbonyl group.
PAGE TOP