What is the product name of the substance with CAS number 9004-99-3?
The product name is Glycols, polyethylene, monostearate.
What is the synonym for Glycols, polyethylene, monostearate?
The synonym is Polyethylene glycol monostearate.
What is the IUPAC name of Glycols, polyethylene, monostearate?
The IUPAC Name is 2-Hydroxyethyl octadecanoate.
What is the molecular formula of Glycols, polyethylene, monostearate?
The molecular formula is (C2H4O)n.C18H36O2.
What is the structure of Glycols, polyethylene, monostearate shown as in SMILES notation?
The structure is CCCCCCCCCCCCCCCCCC(=O)OCCO.
What is the InChI Key of Glycols, polyethylene, monostearate?
The InChI Key is InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3.
What is the melting point of Glycols, polyethylene, monostearate?
The melting point is 47 °C.
What is the flash point of Glycols, polyethylene, monostearate?
The flash point is 39 °C.
What is the percentage of actives present in Glycols, polyethylene, monostearate?
The percentage of actives is 95%.
What are the typical applications of Glycols, polyethylene, monostearate?
The typical applications include being used as an emulsifier and dispersing agent.
PAGE TOP