What is the CAS number for Glycol dioleate?
The CAS number for Glycol dioleate is 928-24-5.
What are the synonyms for Glycol dioleate?
The synonyms for Glycol dioleate are 1,2-ethanediyl dioleate.
What is the molecular weight of Glycol dioleate?
The molecular weight of Glycol dioleate is 590.96.
What is the molecular formula of Glycol dioleate?
The molecular formula of Glycol dioleate is C38H70O4.
What is the InChI Key for Glycol dioleate?
The InChI Key for Glycol dioleate is InChI=1S/C38H70O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(39)41-35-36-42-38(40)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/b19-17-,20-18-.
What is the boiling point of Glycol dioleate?
The boiling point of Glycol dioleate is 633.5±48.0°C.
What is the density of Glycol dioleate?
The density of Glycol dioleate is 0.909±0.06g/ml.
What percentage of actives does Glycol dioleate contain?
Glycol dioleate contains 95% actives.
What is the physical state of Glycol dioleate?
Glycol dioleate is in a liquid physical state.
What are some typical applications of Glycol dioleate?
Some typical applications of Glycol dioleate include being used as an emollient, thickener, and for viscosity controlling purposes.