What is the IUPAC name of Glycol dilaurate?
The IUPAC name of Glycol dilaurate is 2-Dodecanoyloxyethyl dodecanoate.
What is the CAS number of Glycol dilaurate?
The CAS number of Glycol dilaurate is 624-04-4.
What is the molecular weight of Glycol dilaurate?
The molecular weight of Glycol dilaurate is 426.67.
What is the molecular formula of Glycol dilaurate?
The molecular formula of Glycol dilaurate is C26H50O4.
What is the SMILES notation for Glycol dilaurate?
The SMILES notation for Glycol dilaurate is CCCCCCCCCCCC(=O)OCCOC(=O)CCCCCCCCCCC.
What is the InChI key for Glycol dilaurate?
The InChI key for Glycol dilaurate is InChI=1S/C26H50O4/c1-3-5-7-9-11-13-15-17-19-21-25(27)29-23-24-30-26(28)22-20-18-16-14-12-10-8-6-4-2/h3-24H2,1-2H3.
What is the melting point of Glycol dilaurate?
The melting point of Glycol dilaurate is 50-52 °C.
What is the density of Glycol dilaurate?
The density of Glycol dilaurate is 0.958g/ml.
What percentage of actives does Glycol dilaurate contain?
Glycol dilaurate contains 95% actives.
What are some typical applications of Glycol dilaurate?
Some typical applications of Glycol dilaurate include use as a lubricant, dispersing agent, and emulsion stabilizer.
PAGE TOP