What is the PubChem CID of glycine?
PubChem CID 750
What is the molecular formula of glycine?
The molecular formula of glycine is C2H5NO2.
What is the molecular weight of glycine?
The molecular weight of glycine is 75.07 g/mol.
What is the IUPAC name of glycine?
The IUPAC name of glycine is 2-aminoacetic acid.
What is the InChI of glycine?
The InChI of glycine is InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5).
What is the Canonical SMILES of glycine?
The Canonical SMILES of glycine is C(C(=O)O)N.
What is the CAS number of glycine?
The CAS number of glycine is 56-40-6.
What is the European Community (EC) Number of glycine?
The European Community (EC) Number of glycine is 200-272-2.
What is the FEMA Number of glycine?
The FEMA Number of glycine is 3287.
What is the KEGG ID of glycine?
The KEGG ID of glycine is C00037.
PAGE TOP