What is the IUPAC name of Glyceryl Stearates?
The IUPAC name of Glyceryl Stearates is 2,3-Dihydroxypropyl octadecanoate.
What is the molecular formula of Glyceryl Stearates?
The molecular formula of Glyceryl Stearates is C18H36O2.xC3H8O3.
What is the CAS number of Glyceryl Stearates?
The CAS number of Glyceryl Stearates is 11099-07-3.
What is the melting point of Glyceryl Stearates?
The melting point of Glyceryl Stearates is 78-81 °C.
What are some synonyms of Glyceryl Stearates?
Some synonyms of Glyceryl Stearates are Octadecanoic acid, mono-, di- and triesters with 1,2,3-propanetriol and Octadecanoic acid, ester with 1,2,3-propanetriol.
What is the SMILES representation of Glyceryl Stearates?
The SMILES representation of Glyceryl Stearates is CCCCCCCCCCCCCCCCCC(=O)OCC(CO)O.
What are some typical applications of Glyceryl Stearates?
Some typical applications of Glyceryl Stearates are its use as a lubricant, dispersing agent, and emulsion stabilizer.
What is the percentage of actives in Glyceryl Stearates?
The percentage of actives in Glyceryl Stearates is 95%.
What is the physical state of Glyceryl Stearates?
The physical state of Glyceryl Stearates is solid.
What is the InChI Key of Glyceryl Stearates?
The InChI Key of Glyceryl Stearates is InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3.
PAGE TOP