What is the product name of the chemical with CAS number 55840-13-6?
The product name is Glyceryl Stearate Citrate.
What are some synonyms for Glyceryl Stearate Citrate?
Some synonyms are Glycerol stearate citrate, Stearyl monoglyceridyl citrate, and 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ester with 1,2,3-propanetriol monooctadecanoate.
What is the molecular weight of Glyceryl Stearate Citrate?
The molecular weight is 550.68.
What is the molecular formula of Glyceryl Stearate Citrate?
The molecular formula is C27H50O11.
What is the IUPAC name of Glyceryl Stearate Citrate?
The IUPAC name is 3-(Carboxymethyl)-3-hydroxypentanedioic acid;octadecanoic acid;propane-1,2,3-triol.
What is the SMILES notation for Glyceryl Stearate Citrate?
The SMILES notation is CCCCCCCCCCCCCCCCCC(=O)O.C(C(CO)O)O.C(C(=O)O)C(CC(=O)O)(CC(=O)O)O.
What is the InChI key for Glyceryl Stearate Citrate?
The InChI key is InChI=1S/C18H36O2.C7H10O7.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-4(9)1-7(14,2-5(10)11)3-6(12)13;4-1-3(6)2-5/h2-17H2,1H3,(H,19,20);14H,1-3H2,(H,8,9)(H,10,11)(H,12,13);3-6H,1-2H2.
What percentage of actives does Glyceryl Stearate Citrate have?
It has 95% actives.
What is the physical state of Glyceryl Stearate Citrate?
It is in a solid state.
What are some typical applications of Glyceryl Stearate Citrate?
Some typical applications are use as a lubricant, dispersing agent, and emulsion stabilizer.
PAGE TOP