What is the IUPAC name for glyceryl monopalmitate?
The IUPAC name for glyceryl monopalmitate is 2,3-Dihydroxypropyl hexadecanoate.
What is the molecular weight of glyceryl monopalmitate?
The molecular weight of glyceryl monopalmitate is 330.5.
What is the molecular formula of glyceryl monopalmitate?
The molecular formula of glyceryl monopalmitate is C19H38O4.
What is the melting point of glyceryl monopalmitate?
The melting point of glyceryl monopalmitate is 72.5-73 °C.
What is the CAS number of glyceryl monopalmitate?
The CAS number of glyceryl monopalmitate is 26657-96-5.
What are some synonyms for glyceryl monopalmitate?
Some synonyms for glyceryl monopalmitate are Glyceryl palmitate and Hexadecanoic acid, monoester with 1,2,3-propanetriol.
What is the SMILES notation for glyceryl monopalmitate?
The SMILES notation for glyceryl monopalmitate is CCCCCCCCCCCCCCCC(=O)OCC(CO)O.
What is the InChI Key for glyceryl monopalmitate?
The InChI Key for glyceryl monopalmitate is InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3.
What is the physical state of glyceryl monopalmitate?
The physical state of glyceryl monopalmitate is solid.
What are some typical applications of glyceryl monopalmitate?
Some typical applications of glyceryl monopalmitate are use as a lubricant, dispersing agent, and emulsion stabilizer.
PAGE TOP