
What is the molecular weight of Glyceryl monooleate?
The molecular weight of Glyceryl monooleate is 356.54.
What is the IUPAC name of Glyceryl monooleate?
The IUPAC name of Glyceryl monooleate is 2,3-Dihydroxypropyl (Z)-octadec-9-enoate.
What is the CAS number of Glyceryl monooleate?
The CAS number of Glyceryl monooleate is 25496-72-4.
What is the density of Glyceryl monooleate?
The density of Glyceryl monooleate is 0.96g/ml.
What is the boiling point of Glyceryl monooleate?
The boiling point of Glyceryl monooleate is 449.5 °C.
What is the melting point of Glyceryl monooleate?
The melting point of Glyceryl monooleate is 35-37 °C.
What are some synonyms of Glyceryl monooleate?
Some synonyms of Glyceryl monooleate are Glyceryl oleate, Oleic acid, monoester with glycerol, and FEMA No. 2526.
What are the typical applications of Glyceryl monooleate?
The typical applications of Glyceryl monooleate include use as a lubricant, dispersing agent, and emulsion stabilizer.
What is the molecular formula of Glyceryl monooleate?
The molecular formula of Glyceryl monooleate is C21H40O4.
What is the InChI key of Glyceryl monooleate?
The InChI key of Glyceryl monooleate is InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-.