What is the CAS number for Glyceryl hydroxystearate?
The CAS number for Glyceryl hydroxystearate is 1323-42-8.
What are the synonyms for Glyceryl hydroxystearate?
The synonyms for Glyceryl hydroxystearate are Hydroxyoctadecanoic acid, monoester with glycerol, and Octadecanoic acid, hydroxy-, monoester with 1,2,3-propanetriol.
What is the IUPAC name for Glyceryl hydroxystearate?
The IUPAC name for Glyceryl hydroxystearate is 1,3-Dihydroxypropan-2-yl 2-hydroxyoctadecanoate.
What is the molecular weight of Glyceryl hydroxystearate?
The molecular weight of Glyceryl hydroxystearate is 374.56.
What is the molecular formula of Glyceryl hydroxystearate?
The molecular formula of Glyceryl hydroxystearate is C21H42O5.
What is the SMILES notation for Glyceryl hydroxystearate?
The SMILES notation for Glyceryl hydroxystearate is CCCCCCCCCCCCCCCCC(C(=O)OC(CO)CO)O.
What is the InChI for Glyceryl hydroxystearate?
The InChI for Glyceryl hydroxystearate is InChI=1S/C21H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)21(25)26-19(17-22)18-23/h19-20,22-24H,2-18H2,1H3.
What is the percentage of actives in Glyceryl hydroxystearate?
The percentage of actives in Glyceryl hydroxystearate is 95%.
What is the physical state of Glyceryl hydroxystearate?
The physical state of Glyceryl hydroxystearate is solid.
What are some typical applications of Glyceryl hydroxystearate?
Some typical applications of Glyceryl hydroxystearate include use as a lubricant, as a dispersing agent, and as an emulsion stabilizer.