What is the chemical formula of Glyceryl dioleate?
The chemical formula of Glyceryl dioleate is C39H72O5.
What is the CAS number of Glyceryl dioleate?
The CAS number of Glyceryl dioleate is 25637-84-7.
What are some synonyms for Glyceryl dioleate?
Some synonyms for Glyceryl dioleate include Dioleic acid, diester with glycerol and 9-Octadecenoic acid (9Z)-, diester with 1,2,3-propanetriol.
What is the molecular weight of Glyceryl dioleate?
The molecular weight of Glyceryl dioleate is 620.99.
What is the physical state of Glyceryl dioleate?
Glyceryl dioleate is in a liquid physical state.
How is Glyceryl dioleate commonly used?
Glyceryl dioleate is commonly used as a lubricant, dispersing agent, and emulsion stabilizer.
What is the InChI Key of Glyceryl dioleate?
The InChI Key of Glyceryl dioleate is InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-35-37(40)36-44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3.
What is the melting point of Glyceryl dioleate?
The melting point of Glyceryl dioleate is 12 °C.
What is the density range of Glyceryl dioleate?
The density range of Glyceryl dioleate is 0.89-0.92g/ml.
What percentage of actives does Glyceryl dioleate contain?
Glyceryl dioleate contains 95% of actives.