What is the product name of CAS number 538-23-8?
The product name is Glycerol trioctanoate.
What is the molecular weight of Glycerol trioctanoate?
The molecular weight is 470.68.
What is the molecular formula of Glycerol trioctanoate?
The molecular formula is C27H50O6.
What is the boiling point of Glycerol trioctanoate?
The boiling point is 233 °C at 1mmHg.
What is the melting point of Glycerol trioctanoate?
The melting point is 9-10 °C.
What is the density of Glycerol trioctanoate?
The density is 0.956 g/ml.
What are the typical applications of Glycerol trioctanoate?
It is used as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.
What is the percentage of actives in Glycerol trioctanoate?
The percentage of actives is 95%.
How is Glycerol trioctanoate typically used in industrial applications?
It is used as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.
What is the InChI Key of Glycerol trioctanoate?
The InChI Key is InChI=1S/C27H50O6/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h24H,4-23H2,1-3H3.
PAGE TOP