What is the IUPAC name of Glycerol tridecanoate?
The IUPAC name of Glycerol tridecanoate is 2,3-Di(decanoyloxy)propyl decanoate.
What is the CAS number of Glycerol tridecanoate?
The CAS number of Glycerol tridecanoate is 621-71-6.
What is the molecular weight of Glycerol tridecanoate?
The molecular weight of Glycerol tridecanoate is 554.84.
What is the molecular formula of Glycerol tridecanoate?
The molecular formula of Glycerol tridecanoate is C33H62O6.
What is the SMILES notation for Glycerol tridecanoate?
The SMILES notation for Glycerol tridecanoate is CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC.
What is the InChI for Glycerol tridecanoate?
The InChI for Glycerol tridecanoate is LADGBHLMCUINGV-UHFFFAOYSA-N.
What is the typical boiling point of Glycerol tridecanoate?
The typical boiling point of Glycerol tridecanoate is 254 °C at 5mmHg.
What is the melting point range of Glycerol tridecanoate?
The melting point range of Glycerol tridecanoate is 31-32 °C.
What percentage of actives is present in Glycerol tridecanoate?
Glycerol tridecanoate contains 95% actives.
What are some typical applications of Glycerol tridecanoate?
Some typical applications of Glycerol tridecanoate include use as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.