What is the IUPAC name of Ethylpentyl methoxychromone?
The IUPAC name of Ethylpentyl methoxychromone is 2-Heptan-3-yl-7-methoxychromen-4-one.
What is the molecular weight of Ethylpentyl methoxychromone?
The molecular weight of Ethylpentyl methoxychromone is 274.35.
What is the molecular formula of Ethylpentyl methoxychromone?
The molecular formula of Ethylpentyl methoxychromone is C17H22O3.
What is the CAS number of Ethylpentyl methoxychromone?
The CAS number of Ethylpentyl methoxychromone is 171269-68-4.
What are some synonyms of Ethylpentyl methoxychromone?
Some synonyms of Ethylpentyl methoxychromone are 4H-1-Benzopyran-4-one, 2-(1-ethylpentyl)-7-methoxy-.
What is the typical application of Ethylpentyl methoxychromone?
The typical application of Ethylpentyl methoxychromone is as a dispersing agent.
What is the InChI Key of Ethylpentyl methoxychromone?
The InChI Key of Ethylpentyl methoxychromone is InChI=1S/C17H22O3/c1-4-6-7-12(5-2)16-11-15(18)14-9-8-13(19-3)10-17(14)20-16/h8-12H,4-7H2,1-3H3.
What is the physical state of Ethylpentyl methoxychromone?
The physical state of Ethylpentyl methoxychromone is solid.
What is the percentage of actives in Ethylpentyl methoxychromone?
The percentage of actives in Ethylpentyl methoxychromone is 95%.
What is the SMILES code of Ethylpentyl methoxychromone?
The SMILES code of Ethylpentyl methoxychromone is CCCCC(CC)C1=CC(=O)C2=C(O1)C=C(C=C2)OC.
PAGE TOP