
What is the product name of CAS number 199277-69-5?
The product name is Ethylhexyl hydroxystearate benzoate.
What are the synonyms of Ethylhexyl hydroxystearate benzoate?
The synonyms are Octadecanoic acid, 12-(benzoyloxy)-, 2-ethylhexyl ester.
What is the IUPAC name of Ethylhexyl hydroxystearate benzoate?
The IUPAC Name is [18-(2-Ethylhexoxy)-18-oxooctadecan-7-yl] benzoate.
What is the molecular weight of Ethylhexyl hydroxystearate benzoate?
The molecular weight is 516.8.
What is the molecular formula of Ethylhexyl hydroxystearate benzoate?
The molecular formula is C33H56O4.
What is the physical state of Ethylhexyl hydroxystearate benzoate?
The physical state is a paste.
What is the typical application of Ethylhexyl hydroxystearate benzoate?
The typical applications include being an emollient and skin conditioning agent.
What is the percentage of actives in Ethylhexyl hydroxystearate benzoate?
The percentage of actives is 95%.
What is the SMILES notation for Ethylhexyl hydroxystearate benzoate?
The SMILES notation is CCCCCCC(CCCCCCCCCCC(=O)OCC(CC)CCCC)OC(=O)C1=CC=CC=C1.
What is the InChI Key for Ethylhexyl hydroxystearate benzoate?
The InChI Key is InChI=1S/C33H56O4/c1-4-7-9-19-25-31(37-33(35)30-23-17-16-18-24-30)26-20-14-12-10-11-13-15-21-27-32(34)36-28-29(6-3)22-8-5-2/h16-18,23-24,29,31H,4-15,19-22,25-28H2,1-3H3.