What is the CAS number for Ethyl hydroxymethyl oleyl oxazoline?
The CAS number for Ethyl hydroxymethyl oleyl oxazoline is 68140-98-7.
What are some synonyms for Ethyl hydroxymethyl oleyl oxazoline?
Some synonyms for Ethyl hydroxymethyl oleyl oxazoline are 2-(8-Heptadecenyl)-4-ethyl-2-oxazoline-4-methanol and 4-Ethyl-2-(8-heptadecenyl)-2-oxazoline-4-methanol.
What is the IUPAC name for Ethyl hydroxymethyl oleyl oxazoline?
The IUPAC name for Ethyl hydroxymethyl oleyl oxazoline is (4-ethyl-2-heptadec-8-enyl-5H-1,3-oxazol-4-yl)methanol.
What is the molecular weight of Ethyl hydroxymethyl oleyl oxazoline?
The molecular weight of Ethyl hydroxymethyl oleyl oxazoline is 365.59.
What is the molecular formula of Ethyl hydroxymethyl oleyl oxazoline?
The molecular formula of Ethyl hydroxymethyl oleyl oxazoline is C23H43NO2.
What is the SMILES notation for Ethyl hydroxymethyl oleyl oxazoline?
The SMILES notation for Ethyl hydroxymethyl oleyl oxazoline is CCCCCCCCC=CCCCCCCCC1=NC(CO1)(CC)CO.
What is the InChI of Ethyl hydroxymethyl oleyl oxazoline?
The InChI of Ethyl hydroxymethyl oleyl oxazoline is InChI=1S/C23H43NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-24-23(4-2,20-25)21-26-22/h11-12,25H,3-10,13-21H2,1-2H3.
What is the percentage of actives in Ethyl hydroxymethyl oleyl oxazoline?
The percentage of actives in Ethyl hydroxymethyl oleyl oxazoline is 90%.
What is the physical state of Ethyl hydroxymethyl oleyl oxazoline?
The physical state of Ethyl hydroxymethyl oleyl oxazoline is a liquid.
What are some typical applications of Ethyl hydroxymethyl oleyl oxazoline?
Some typical applications of Ethyl hydroxymethyl oleyl oxazoline are as an antistatic agent in textile, chemical fiber, and leather products.
PAGE TOP