What is the IUPAC name of Ethyl D-glucoside?
The IUPAC Name of Ethyl D-glucoside is (3R,4S,5S,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the molecular weight of Ethyl D-glucoside?
The molecular weight of Ethyl D-glucoside is 208.21.
What is the molecular formula of Ethyl D-glucoside?
The molecular formula of Ethyl D-glucoside is C8H16O6.
What is the SMILES notation for Ethyl D-glucoside?
The SMILES notation for Ethyl D-glucoside is CCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O.
What is the InChI for Ethyl D-glucoside?
The InChI for Ethyl D-glucoside is InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3/t4-,5-,6+,7-,8?/m1/s1.
What percentage of Ethyl D-glucoside is actives?
95% of Ethyl D-glucoside is actives.
In what state is Ethyl D-glucoside commonly found?
Ethyl D-glucoside is commonly found in a solid state.
What is the typical application of Ethyl D-glucoside?
The typical application of Ethyl D-glucoside is as a humectant.
What is the CAS number for Ethyl D-glucoside?
The CAS number for Ethyl D-glucoside is 30285-48-4.
What are some synonyms for Ethyl D-glucoside?
Some synonyms for Ethyl D-glucoside are Glucoside, ethyl, D-.
PAGE TOP