What is the CAS number for Ethyl butylacetylaminopropionate?
The CAS number for Ethyl butylacetylaminopropionate is 52304-36-6.
What are some synonyms for Ethyl butylacetylaminopropionate?
Some synonyms for Ethyl butylacetylaminopropionate include Ethyl N-acetyl-N-butyl-beta-alaninate and beta-Alanine, N-acetyl-N-butyl-, ethyl ester.
What is the IUPAC Name of Ethyl butylacetylaminopropionate?
The IUPAC Name of Ethyl butylacetylaminopropionate is Ethyl 3-[acetyl(butyl)amino]propanoate.
What is the molecular weight of Ethyl butylacetylaminopropionate?
The molecular weight of Ethyl butylacetylaminopropionate is 215.29.
What is the molecular formula of Ethyl butylacetylaminopropionate?
The molecular formula of Ethyl butylacetylaminopropionate is C11H21NO3.
What is the physical state of Ethyl butylacetylaminopropionate?
The physical state of Ethyl butylacetylaminopropionate is a liquid.
What is the density of Ethyl butylacetylaminopropionate?
The density of Ethyl butylacetylaminopropionate is 0.987±0.06g/ml.
What are the typical applications of Ethyl butylacetylaminopropionate?
The typical applications of Ethyl butylacetylaminopropionate include use as a dispersing agent, emulsion stabilizer, lubricant, and insect repellent.
What is the percentage of actives in Ethyl butylacetylaminopropionate?
The percentage of actives in Ethyl butylacetylaminopropionate is 95%.
What is the InChI Key for Ethyl butylacetylaminopropionate?
The InChI Key for Ethyl butylacetylaminopropionate is InChI=1S/C11H21NO3/c1-4-6-8-12(10(3)13)9-7-11(14)15-5-2/h4-9H2,1-3H3.
PAGE TOP